C10H4ClF5N4 — CID 115564038
6-chloro-4-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-4,5-diamine (PubChem CID 115564038) has the molecular formula C10H4ClF5N4 and a molecular weight of 310.61 g/mol. Its IUPAC name is 6-chloro-4-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-chloro-4-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 115564038 |
| Molecular Formula | C10H4ClF5N4 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 6-chloro-4-N-(2,3,4,5,6-pentafluorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Cl)ncnc1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H4ClF5N4/c11-9-7(17)10(19-1-18-9)20-8-5(15)3(13)2(12)4(14)6(8)16/h1H,17H2,(H,18,19,20) |
| InChIKey | BUIMAUQAVVOTFE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|