C11H8F5N3 — CID 115564140
2,3,4,5,6-pentafluoro-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline (PubChem CID 115564140) has the molecular formula C11H8F5N3 and a molecular weight of 277.20 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 115564140 |
| Molecular Formula | C11H8F5N3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(5-methyl-1H-imidazol-4-yl)methyl]aniline |
| SMILES | Cc1[nH]cnc1CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5N3/c1-4-5(19-3-18-4)2-17-11-9(15)7(13)6(12)8(14)10(11)16/h3,17H,2H2,1H3,(H,18,19) |
| InChIKey | LZNZWPOWUCOKSY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|