C12H9F5N2OS — CID 115564577
1-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)cyclobutane-1-carboxamide (PubChem CID 115564577) has the molecular formula C12H9F5N2OS and a molecular weight of 324.27 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115564577 |
| Molecular Formula | C12H9F5N2OS |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 1-carbamothioyl-N-(2,3,4,5,6-pentafluorophenyl)cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)CCC1 |
| InChI | InChI=1S/C12H9F5N2OS/c13-4-5(14)7(16)9(8(17)6(4)15)19-11(20)12(10(18)21)2-1-3-12/h1-3H2,(H2,18,21)(H,19,20) |
| InChIKey | XXBWBCJHEOSBMD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|