C11H8F5N3S — CID 115564667
4-(2,3,4,5,6-pentafluorophenyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione (PubChem CID 115564667) has the molecular formula C11H8F5N3S and a molecular weight of 309.26 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentafluorophenyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,3,4,5,6-pentafluorophenyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115564667 |
| Molecular Formula | C11H8F5N3S |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-(2,3,4,5,6-pentafluorophenyl)-3-propan-2-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CC(C)c1n[nH]c(=S)n1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8F5N3S/c1-3(2)10-17-18-11(20)19(10)9-7(15)5(13)4(12)6(14)8(9)16/h3H,1-2H3,(H,18,20) |
| InChIKey | LXTYJKYDQMUODF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|