C12H11F5N2S — CID 115564682
(4S)-N-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 115564682) has the molecular formula C12H11F5N2S and a molecular weight of 310.29 g/mol. Its IUPAC name is (4S)-N-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (4S)-N-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115564682 |
| Molecular Formula | C12H11F5N2S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4S)-N-(2,3,4,5,6-pentafluorophenyl)-4-propan-2-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(C)[C@H]1CSC(Nc2c(F)c(F)c(F)c(F)c2F)=N1 |
| InChI | InChI=1S/C12H11F5N2S/c1-4(2)5-3-20-12(18-5)19-11-9(16)7(14)6(13)8(15)10(11)17/h4-5H,3H2,1-2H3,(H,18,19)/t5-/m1/s1 |
| InChIKey | HHLGXVXNJCLGCJ-RXMQYKEDSA-N |
| XLogP | 3.92 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|