C13H13F5N2S — CID 115564684
4,4-diethyl-N-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-thiazol-2-amine (PubChem CID 115564684) has the molecular formula C13H13F5N2S and a molecular weight of 324.32 g/mol. Its IUPAC name is 4,4-diethyl-N-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-thiazol-2-amine.
| Compound Name | 4,4-diethyl-N-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115564684 |
| Molecular Formula | C13H13F5N2S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4,4-diethyl-N-(2,3,4,5,6-pentafluorophenyl)-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2c(F)c(F)c(F)c(F)c2F)=N1 |
| InChI | InChI=1S/C13H13F5N2S/c1-3-13(4-2)5-21-12(20-13)19-11-9(17)7(15)6(14)8(16)10(11)18/h3-5H2,1-2H3,(H,19,20) |
| InChIKey | XMMNWOGQIXUQDE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|