C10H7F5N2S — CID 115564685
5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 115564685) has the molecular formula C10H7F5N2S and a molecular weight of 282.24 g/mol. Its IUPAC name is 5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115564685 |
| Molecular Formula | C10H7F5N2S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-methyl-N-(2,3,4,5,6-pentafluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC1CN=C(Nc2c(F)c(F)c(F)c(F)c2F)S1 |
| InChI | InChI=1S/C10H7F5N2S/c1-3-2-16-10(18-3)17-9-7(14)5(12)4(11)6(13)8(9)15/h3H,2H2,1H3,(H,16,17) |
| InChIKey | RPWFCRHOXUGPCL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|