C11H7F5N2S — CID 115564800
4-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine (PubChem CID 115564800) has the molecular formula C11H7F5N2S and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115564800 |
| Molecular Formula | C11H7F5N2S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-methyl-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(N)sc1Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H7F5N2S/c1-3-5(19-11(17)18-3)2-4-6(12)8(14)10(16)9(15)7(4)13/h2H2,1H3,(H2,17,18) |
| InChIKey | GHVGFQKKDHFUBC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|