C30H25IN2O7 — CID 11556497
[(2R,3S,5R)-3-benzoyloxy-5-[5-iodo-3-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate (PubChem CID 11556497) has the molecular formula C30H25IN2O7 and a molecular weight of 652.44 g/mol. Its IUPAC name is [(2R,3S,5R)-3-benzoyloxy-5-[5-iodo-3-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,5R)-3-benzoyloxy-5-[5-iodo-3-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11556497 |
| Molecular Formula | C30H25IN2O7 |
| Molecular Weight | 652.44 g/mol |
| Exact Mass | 652.07 |
| IUPAC Name | [(2R,3S,5R)-3-benzoyloxy-5-[5-iodo-3-(4-methylphenyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl benzoate |
| SMILES | Cc1ccc(-n2c(=O)c(I)cn([C@H]3C[C@H](OC(=O)c4ccccc4)[C@@H](COC(=O)c4ccccc4)O3)c2=O)cc1 |
| InChI | InChI=1S/C30H25IN2O7/c1-19-12-14-22(15-13-19)33-27(34)23(31)17-32(30(33)37)26-16-24(40-29(36)21-10-6-3-7-11-21)25(39-26)18-38-28(35)20-8-4-2-5-9-20/h2-15,17,24-26H,16,18H2,1H3/t24-,25+,26+/m0/s1 |
| InChIKey | PCMMDSAOKJLZLI-JIMJEQGWSA-N |
| XLogP | 4.28 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|