C10H7F5N2O — CID 115565456
1-(2,3,4,5,6-pentafluorophenyl)-1,3-diazinan-2-one (PubChem CID 115565456) has the molecular formula C10H7F5N2O and a molecular weight of 266.17 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-1,3-diazinan-2-one.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115565456 |
| Molecular Formula | C10H7F5N2O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F5N2O/c11-4-5(12)7(14)9(8(15)6(4)13)17-3-1-2-16-10(17)18/h1-3H2,(H,16,18) |
| InChIKey | KWGGOSDAMJAFMO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|