C13H12BrClN2O2 — CID 115565725
2-(3-bromo-4-chlorophenyl)-4-hydroxy-5-propyl-1H-pyrimidin-6-one (PubChem CID 115565725) has the molecular formula C13H12BrClN2O2 and a molecular weight of 343.61 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-4-hydroxy-5-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-4-hydroxy-5-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 115565725 |
| Molecular Formula | C13H12BrClN2O2 |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-4-hydroxy-5-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1c(O)nc(-c2ccc(Cl)c(Br)c2)[nH]c1=O |
| InChI | InChI=1S/C13H12BrClN2O2/c1-2-3-8-12(18)16-11(17-13(8)19)7-4-5-10(15)9(14)6-7/h4-6H,2-3H2,1H3,(H2,16,17,18,19) |
| InChIKey | OEKNBJSYHBWLDF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |