C10H4BrCl3N2 — CID 115565759
2-(3-bromo-4-chlorophenyl)-4,6-dichloropyrimidine (PubChem CID 115565759) has the molecular formula C10H4BrCl3N2 and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-4,6-dichloropyrimidine.
| Compound Name | 2-(3-bromo-4-chlorophenyl)-4,6-dichloropyrimidine |
|---|---|
| PubChem CID | 115565759 |
| Molecular Formula | C10H4BrCl3N2 |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 335.86 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-4,6-dichloropyrimidine |
| SMILES | Clc1cc(Cl)nc(-c2ccc(Cl)c(Br)c2)n1 |
| InChI | InChI=1S/C10H4BrCl3N2/c11-6-3-5(1-2-7(6)12)10-15-8(13)4-9(14)16-10/h1-4H |
| InChIKey | YSKYDQNJUZLYIR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |