C13H19BrClN — CID 115567963
1-(3-bromo-4-chlorophenyl)-2-methyl-N-propylpropan-1-amine (PubChem CID 115567963) has the molecular formula C13H19BrClN and a molecular weight of 304.66 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-2-methyl-N-propylpropan-1-amine.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 115567963 |
| Molecular Formula | C13H19BrClN |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-2-methyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)c(Br)c1)C(C)C |
| InChI | InChI=1S/C13H19BrClN/c1-4-7-16-13(9(2)3)10-5-6-12(15)11(14)8-10/h5-6,8-9,13,16H,4,7H2,1-3H3 |
| InChIKey | AKSCPUFKDVTLNZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |