C42H40Cl2F3NO7S — CID 11556907
bis(prop-2-enyl) 2-[2-[4-[(4-tert-butylphenyl)methyl-(3,4-dichlorophenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate (PubChem CID 11556907) has the molecular formula C42H40Cl2F3NO7S and a molecular weight of 830.75 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[2-[4-[(4-tert-butylphenyl)methyl-(3,4-dichlorophenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[2-[4-[(4-tert-butylphenyl)methyl-(3,4-dichlorophenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 11556907 |
| Molecular Formula | C42H40Cl2F3NO7S |
| Molecular Weight | 830.75 g/mol |
| Exact Mass | 829.19 |
| IUPAC Name | bis(prop-2-enyl) 2-[2-[4-[(4-tert-butylphenyl)methyl-(3,4-dichlorophenyl)sulfonylamino]phenyl]-2-oxoethyl]-2-[[3-(trifluoromethyl)phenyl]methyl]propanedioate |
| SMILES | C=CCOC(=O)C(CC(=O)c1ccc(N(Cc2ccc(C(C)(C)C)cc2)S(=O)(=O)c2ccc(Cl)c(Cl)c2)cc1)(Cc1cccc(C(F)(F)F)c1)C(=O)OCC=C |
| InChI | InChI=1S/C42H40Cl2F3NO7S/c1-6-21-54-38(50)41(39(51)55-22-7-2,25-29-9-8-10-32(23-29)42(45,46)47)26-37(49)30-13-17-33(18-14-30)48(27-28-11-15-31(16-12-28)40(3,4)5)56(52,53)34-19-20-35(43)36(44)24-34/h6-20,23-24H,1-2,21-22,25-27H2,3-5H3 |
| InChIKey | MCBACWFQVNQUCQ-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.75 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|