C49H95N5O3 — CID 11556967
(Z)-N-[4-[[(2R)-2,6-diaminohexanoyl]-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]butyl]octadec-9-enamide (PubChem CID 11556967) has the molecular formula C49H95N5O3 and a molecular weight of 802.33 g/mol. Its IUPAC name is (Z)-N-[4-[[(2R)-2,6-diaminohexanoyl]-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]butyl]octadec-9-enamide.
| Compound Name | (Z)-N-[4-[[(2R)-2,6-diaminohexanoyl]-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]butyl]octadec-9-enamide |
|---|---|
| PubChem CID | 11556967 |
| Molecular Formula | C49H95N5O3 |
| Molecular Weight | 802.33 g/mol |
| Exact Mass | 801.74 |
| IUPAC Name | (Z)-N-[4-[[(2R)-2,6-diaminohexanoyl]-[3-[[(Z)-octadec-9-enoyl]amino]propyl]amino]butyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCCCN(CCCNC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)[C@H](N)CCCCN |
| InChI | InChI=1S/C49H95N5O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-39-47(55)52-42-35-36-44-54(49(57)46(51)38-33-34-41-50)45-37-43-53-48(56)40-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,46H,3-16,21-45,50-51H2,1-2H3,(H,52,55)(H,53,56)/b19-17-,20-18-/t46-/m1/s1 |
| InChIKey | YOTIVADFQXUFKC-INSDLJCRSA-N |
| XLogP | 11.75 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.33 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|