C12H17ClN2S — CID 115570972
1-[(4-chlorophenyl)methyl]-1-methyl-3-propylthiourea (PubChem CID 115570972) has the molecular formula C12H17ClN2S and a molecular weight of 256.80 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-methyl-3-propylthiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-methyl-3-propylthiourea |
|---|---|
| PubChem CID | 115570972 |
| Molecular Formula | C12H17ClN2S |
| Molecular Weight | 256.80 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-methyl-3-propylthiourea |
| SMILES | CCCNC(=S)N(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN2S/c1-3-8-14-12(16)15(2)9-10-4-6-11(13)7-5-10/h4-7H,3,8-9H2,1-2H3,(H,14,16) |
| InChIKey | IPUSNNDKUSIPHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.80 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|