C14H21FN2OS — CID 115571209
1-(3-ethoxypropyl)-3-[2-(2-fluorophenyl)ethyl]thiourea (PubChem CID 115571209) has the molecular formula C14H21FN2OS and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(2-fluorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(2-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 115571209 |
| Molecular Formula | C14H21FN2OS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(2-fluorophenyl)ethyl]thiourea |
| SMILES | CCOCCCNC(=S)NCCc1ccccc1F |
| InChI | InChI=1S/C14H21FN2OS/c1-2-18-11-5-9-16-14(19)17-10-8-12-6-3-4-7-13(12)15/h3-4,6-7H,2,5,8-11H2,1H3,(H2,16,17,19) |
| InChIKey | QTBVDXLGELSQGY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|