C16H23N3O2 — CID 115571404
3-butoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine (PubChem CID 115571404) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-butoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115571404 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-butoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-3-11-20-12-7-10-17-13-15-18-19-16(21-15)14-8-5-4-6-9-14/h4-6,8-9,17H,2-3,7,10-13H2,1H3 |
| InChIKey | BCIHFSLJIJAPRO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|