C6H8O3 — CID 11557285
(1R,2R,3S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol (PubChem CID 11557285) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (1R,2R,3S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol.
| Compound Name | (1R,2R,3S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol |
|---|---|
| PubChem CID | 11557285 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (1R,2R,3S,4S)-7-oxabicyclo[2.2.1]hept-5-ene-2,3-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C6H8O3/c7-5-3-1-2-4(9-3)6(5)8/h1-8H/t3-,4+,5+,6- |
| InChIKey | YATRXMNGSLWFHT-GUCUJZIJSA-N |
| XLogP | -0.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|