C17H25N3O — CID 115573877
3-butoxy-N-[(4-pyrazol-1-ylphenyl)methyl]propan-1-amine (PubChem CID 115573877) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-butoxy-N-[(4-pyrazol-1-ylphenyl)methyl]propan-1-amine.
| Compound Name | 3-butoxy-N-[(4-pyrazol-1-ylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115573877 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-butoxy-N-[(4-pyrazol-1-ylphenyl)methyl]propan-1-amine |
| SMILES | CCCCOCCCNCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-2-3-13-21-14-5-10-18-15-16-6-8-17(9-7-16)20-12-4-11-19-20/h4,6-9,11-12,18H,2-3,5,10,13-15H2,1H3 |
| InChIKey | UHVVDCFRXRXZPH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|