About ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate
ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate (PubChem CID 11557404) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate |
| PubChem CID | 11557404 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12CC[C@H](O)[C@@H]1O2 |
| InChI | InChI=1S/C9H14O4/c1-2-12-7(11)5-9-4-3-6(10)8(9)13-9/h6,8,10H,2-5H2,1H3/t6-,8-,9-/m0/s1 |
| InChIKey | GVFZEWNEQNKDTQ-XVYDVKMFSA-N |
| XLogP | 0.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate?
The IUPAC name of ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate (CID 11557404) is ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate.
What is the SMILES notation for ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate?
The canonical SMILES for ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate is CCOC(=O)C[C@@]12CC[C@H](O)[C@@H]1O2.
What is the InChIKey of ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate?
The InChIKey is GVFZEWNEQNKDTQ-XVYDVKMFSA-N. The full InChI is InChI=1S/C9H14O4/c1-2-12-7(11)5-9-4-3-6(10)8(9)13-9/h6,8,10H,2-5H2,1H3/t6-,8-,9-/m0/s1.
What are the key properties of ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate?
ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate has a molecular weight of 186.21 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(1S,4S,5S)-4-hydroxy-6-oxabicyclo[3.1.0]hexan-1-yl]acetate is sourced from PubChem (CID 11557404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).