C12H18O2 — CID 11557454
1-[(1R,2R,5R)-2-ethenyl-1-methyl-5-[(2R)-oxiran-2-yl]cyclopentyl]ethanone (PubChem CID 11557454) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-[(1R,2R,5R)-2-ethenyl-1-methyl-5-[(2R)-oxiran-2-yl]cyclopentyl]ethanone.
| Compound Name | 1-[(1R,2R,5R)-2-ethenyl-1-methyl-5-[(2R)-oxiran-2-yl]cyclopentyl]ethanone |
|---|---|
| PubChem CID | 11557454 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-[(1R,2R,5R)-2-ethenyl-1-methyl-5-[(2R)-oxiran-2-yl]cyclopentyl]ethanone |
| SMILES | C=C[C@H]1CC[C@@H]([C@@H]2CO2)[C@]1(C)C(C)=O |
| InChI | InChI=1S/C12H18O2/c1-4-9-5-6-10(11-7-14-11)12(9,3)8(2)13/h4,9-11H,1,5-7H2,2-3H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | YRCHDWMBHWGKSO-FIQHERPVSA-N |
| XLogP | 2.19 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|