C13H17F3N2OS — CID 115575039
1-(3-methoxypropyl)-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea (PubChem CID 115575039) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 115575039 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[[4-(trifluoromethyl)phenyl]methyl]thiourea |
| SMILES | COCCCNC(=S)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17F3N2OS/c1-19-8-2-7-17-12(20)18-9-10-3-5-11(6-4-10)13(14,15)16/h3-6H,2,7-9H2,1H3,(H2,17,18,20) |
| InChIKey | VGRIGQORACKTLE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|