C11H11N3S — CID 11557582
4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)aniline (PubChem CID 11557582) has the molecular formula C11H11N3S and a molecular weight of 217.30 g/mol. Its IUPAC name is 4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)aniline.
| Compound Name | 4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)aniline |
|---|---|
| PubChem CID | 11557582 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)aniline |
| SMILES | Nc1ccc(C2=CSC3=NCCN23)cc1 |
| InChI | InChI=1S/C11H11N3S/c12-9-3-1-8(2-4-9)10-7-15-11-13-5-6-14(10)11/h1-4,7H,5-6,12H2 |
| InChIKey | URHXFMOERPVENY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|