C14H12ClN3O3 — CID 115576070
N-(6-chloro-3-nitro-2-pyridinyl)-3,5-dimethylbenzamide (PubChem CID 115576070) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is N-(6-chloro-3-nitro-2-pyridinyl)-3,5-dimethylbenzamide.
| Compound Name | N-(6-chloro-3-nitro-2-pyridinyl)-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 115576070 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-(6-chloro-3-nitro-2-pyridinyl)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2nc(Cl)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12ClN3O3/c1-8-5-9(2)7-10(6-8)14(19)17-13-11(18(20)21)3-4-12(15)16-13/h3-7H,1-2H3,(H,16,17,19) |
| InChIKey | ASIOTFCMGFBXOT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|