C8H12N4O — CID 115576603
1-cyclopropyl-3-(1-methylpyrazol-3-yl)urea (PubChem CID 115576603) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-cyclopropyl-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-cyclopropyl-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 115576603 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-cyclopropyl-3-(1-methylpyrazol-3-yl)urea |
| SMILES | Cn1ccc(NC(=O)NC2CC2)n1 |
| InChI | InChI=1S/C8H12N4O/c1-12-5-4-7(11-12)10-8(13)9-6-2-3-6/h4-6H,2-3H2,1H3,(H2,9,10,11,13) |
| InChIKey | GOFPOIMEOFHWEP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |