About (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one
(2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one (PubChem CID 11557663) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one |
| PubChem CID | 11557663 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one |
| SMILES | C[C@H](O)CCCCC[C@H](O)[C@@H]1C=CC(=O)O1 |
| InChI | InChI=1S/C12H20O4/c1-9(13)5-3-2-4-6-10(14)11-7-8-12(15)16-11/h7-11,13-14H,2-6H2,1H3/t9-,10-,11-/m0/s1 |
| InChIKey | XQIRBHFARGUNIX-DCAQKATOSA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one?
The IUPAC name of (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one (CID 11557663) is (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one.
What is the SMILES notation for (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one?
The canonical SMILES for (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one is C[C@H](O)CCCCC[C@H](O)[C@@H]1C=CC(=O)O1.
What is the InChIKey of (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one?
The InChIKey is XQIRBHFARGUNIX-DCAQKATOSA-N. The full InChI is InChI=1S/C12H20O4/c1-9(13)5-3-2-4-6-10(14)11-7-8-12(15)16-11/h7-11,13-14H,2-6H2,1H3/t9-,10-,11-/m0/s1.
What are the key properties of (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one?
(2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one has a molecular weight of 228.29 g/mol, XLogP of 1.16, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(1S,7S)-1,7-dihydroxyoctyl]-2H-furan-5-one is sourced from PubChem (CID 11557663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).