C10H24N2O2S — CID 115577345
N'-tert-butyl-N-(2-methylsulfonylethyl)propane-1,3-diamine (PubChem CID 115577345) has the molecular formula C10H24N2O2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N'-tert-butyl-N-(2-methylsulfonylethyl)propane-1,3-diamine.
| Compound Name | N'-tert-butyl-N-(2-methylsulfonylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115577345 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N'-tert-butyl-N-(2-methylsulfonylethyl)propane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNCCS(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O2S/c1-10(2,3)12-7-5-6-11-8-9-15(4,13)14/h11-12H,5-9H2,1-4H3 |
| InChIKey | CJLVYXXMAQUZJX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|