C12H22N4S — CID 115577702
1-butyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiourea (PubChem CID 115577702) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 1-butyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiourea.
| Compound Name | 1-butyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiourea |
|---|---|
| PubChem CID | 115577702 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-butyl-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]thiourea |
| SMILES | CCCCNC(=S)NCCCc1cn[nH]c1C |
| InChI | InChI=1S/C12H22N4S/c1-3-4-7-13-12(17)14-8-5-6-11-9-15-16-10(11)2/h9H,3-8H2,1-2H3,(H,15,16)(H2,13,14,17) |
| InChIKey | ZXVUUUKHQJLXDJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|