About 1-(1-cyclopropylethyl)-1,3-dimethylthiourea
1-(1-cyclopropylethyl)-1,3-dimethylthiourea (PubChem CID 115577713) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 1-(1-cyclopropylethyl)-1,3-dimethylthiourea.
Molecular Properties
| Compound Name | 1-(1-cyclopropylethyl)-1,3-dimethylthiourea |
| PubChem CID | 115577713 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1-(1-cyclopropylethyl)-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)C(C)C1CC1 |
| InChI | InChI=1S/C8H16N2S/c1-6(7-4-5-7)10(3)8(11)9-2/h6-7H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | QJVDPDOEUQNZRL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-cyclopropylethyl)-1,3-dimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopropylethyl)-1,3-dimethylthiourea?
The IUPAC name of 1-(1-cyclopropylethyl)-1,3-dimethylthiourea (CID 115577713) is 1-(1-cyclopropylethyl)-1,3-dimethylthiourea.
What is the SMILES notation for 1-(1-cyclopropylethyl)-1,3-dimethylthiourea?
The canonical SMILES for 1-(1-cyclopropylethyl)-1,3-dimethylthiourea is CNC(=S)N(C)C(C)C1CC1.
What is the InChIKey of 1-(1-cyclopropylethyl)-1,3-dimethylthiourea?
The InChIKey is QJVDPDOEUQNZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-6(7-4-5-7)10(3)8(11)9-2/h6-7H,4-5H2,1-3H3,(H,9,11).
What are the key properties of 1-(1-cyclopropylethyl)-1,3-dimethylthiourea?
1-(1-cyclopropylethyl)-1,3-dimethylthiourea has a molecular weight of 172.30 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopropylethyl)-1,3-dimethylthiourea is sourced from PubChem (CID 115577713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).