C10H10F2N2S — CID 115578027
5,6-difluoro-1-(2-methylsulfanylethyl)benzimidazole (PubChem CID 115578027) has the molecular formula C10H10F2N2S and a molecular weight of 228.27 g/mol. Its IUPAC name is 5,6-difluoro-1-(2-methylsulfanylethyl)benzimidazole.
| Compound Name | 5,6-difluoro-1-(2-methylsulfanylethyl)benzimidazole |
|---|---|
| PubChem CID | 115578027 |
| Molecular Formula | C10H10F2N2S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 5,6-difluoro-1-(2-methylsulfanylethyl)benzimidazole |
| SMILES | CSCCn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C10H10F2N2S/c1-15-3-2-14-6-13-9-4-7(11)8(12)5-10(9)14/h4-6H,2-3H2,1H3 |
| InChIKey | QRVGUWCFBNWPJJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |