C8H11F3N2O4S — CID 115578460
5-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione (PubChem CID 115578460) has the molecular formula C8H11F3N2O4S and a molecular weight of 288.25 g/mol. Its IUPAC name is 5-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 115578460 |
| Molecular Formula | C8H11F3N2O4S |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-(2-methylsulfonylethyl)-3-(2,2,2-trifluoroethyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)CCC1NC(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C8H11F3N2O4S/c1-18(16,17)3-2-5-6(14)13(7(15)12-5)4-8(9,10)11/h5H,2-4H2,1H3,(H,12,15) |
| InChIKey | HWRPOAAYKTXFFP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|