About 3-heptan-2-yl-1,1-dimethylurea
3-heptan-2-yl-1,1-dimethylurea (PubChem CID 115578838) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-heptan-2-yl-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-heptan-2-yl-1,1-dimethylurea |
| PubChem CID | 115578838 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 3-heptan-2-yl-1,1-dimethylurea |
| SMILES | CCCCCC(C)NC(=O)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-5-6-7-8-9(2)11-10(13)12(3)4/h9H,5-8H2,1-4H3,(H,11,13) |
| InChIKey | MYVBLPOJOACEEH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-heptan-2-yl-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-heptan-2-yl-1,1-dimethylurea?
The IUPAC name of 3-heptan-2-yl-1,1-dimethylurea (CID 115578838) is 3-heptan-2-yl-1,1-dimethylurea.
What is the SMILES notation for 3-heptan-2-yl-1,1-dimethylurea?
The canonical SMILES for 3-heptan-2-yl-1,1-dimethylurea is CCCCCC(C)NC(=O)N(C)C.
What is the InChIKey of 3-heptan-2-yl-1,1-dimethylurea?
The InChIKey is MYVBLPOJOACEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-5-6-7-8-9(2)11-10(13)12(3)4/h9H,5-8H2,1-4H3,(H,11,13).
What are the key properties of 3-heptan-2-yl-1,1-dimethylurea?
3-heptan-2-yl-1,1-dimethylurea has a molecular weight of 186.30 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-heptan-2-yl-1,1-dimethylurea is sourced from PubChem (CID 115578838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).