C10H20N2S — CID 115578977
1-cyclopropyl-3-methyl-1-(3-methylbutyl)thiourea (PubChem CID 115578977) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-cyclopropyl-3-methyl-1-(3-methylbutyl)thiourea.
| Compound Name | 1-cyclopropyl-3-methyl-1-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 115578977 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-cyclopropyl-3-methyl-1-(3-methylbutyl)thiourea |
| SMILES | CNC(=S)N(CCC(C)C)C1CC1 |
| InChI | InChI=1S/C10H20N2S/c1-8(2)6-7-12(9-4-5-9)10(13)11-3/h8-9H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | PJPUQSKZSMZMIZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|