About 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde
4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde (PubChem CID 11557934) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde.
Molecular Properties
| Compound Name | 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde |
| PubChem CID | 11557934 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde |
| SMILES | CSc1ccc(-c2cc(C=O)nc(C=O)c2)cc1 |
| InChI | InChI=1S/C14H11NO2S/c1-18-14-4-2-10(3-5-14)11-6-12(8-16)15-13(7-11)9-17/h2-9H,1H3 |
| InChIKey | IYNSYAQCAIECEW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde?
The IUPAC name of 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde (CID 11557934) is 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde.
What is the SMILES notation for 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde?
The canonical SMILES for 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde is CSc1ccc(-c2cc(C=O)nc(C=O)c2)cc1.
What is the InChIKey of 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde?
The InChIKey is IYNSYAQCAIECEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c1-18-14-4-2-10(3-5-14)11-6-12(8-16)15-13(7-11)9-17/h2-9H,1H3.
What are the key properties of 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde?
4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde has a molecular weight of 257.31 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylsulfanylphenyl)pyridine-2,6-dicarbaldehyde is sourced from PubChem (CID 11557934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).