About 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol
2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol (PubChem CID 11557972) has the molecular formula C10H10Cl2N2O2
and a molecular weight of 261.11 g/mol. Its IUPAC name is 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol.
Molecular Properties
| Compound Name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol |
| PubChem CID | 11557972 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol |
| SMILES | CC(O)(CO)c1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-10(16,4-15)9-13-7-2-5(11)6(12)3-8(7)14-9/h2-3,15-16H,4H2,1H3,(H,13,14) |
| InChIKey | VDUGNZJFJGJXPE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol?
The IUPAC name of 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol (CID 11557972) is 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol.
What is the SMILES notation for 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol?
The canonical SMILES for 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol is CC(O)(CO)c1nc2cc(Cl)c(Cl)cc2[nH]1.
What is the InChIKey of 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol?
The InChIKey is VDUGNZJFJGJXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N2O2/c1-10(16,4-15)9-13-7-2-5(11)6(12)3-8(7)14-9/h2-3,15-16H,4H2,1H3,(H,13,14).
What are the key properties of 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol?
2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol has a molecular weight of 261.11 g/mol, XLogP of 2.07, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dichloro-1H-benzimidazol-2-yl)propane-1,2-diol is sourced from PubChem (CID 11557972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).