C10H18N2OS — CID 115580686
N-cyclopropyl-2,2-dimethylmorpholine-4-carbothioamide (PubChem CID 115580686) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is N-cyclopropyl-2,2-dimethylmorpholine-4-carbothioamide.
| Compound Name | N-cyclopropyl-2,2-dimethylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 115580686 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-cyclopropyl-2,2-dimethylmorpholine-4-carbothioamide |
| SMILES | CC1(C)CN(C(=S)NC2CC2)CCO1 |
| InChI | InChI=1S/C10H18N2OS/c1-10(2)7-12(5-6-13-10)9(14)11-8-3-4-8/h8H,3-7H2,1-2H3,(H,11,14) |
| InChIKey | DLHYHZDKASIJBV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|