C10H16N2O2 — CID 115581572
1-ethyl-1-(furan-2-ylmethyl)-3,3-dimethylurea (PubChem CID 115581572) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-ethyl-1-(furan-2-ylmethyl)-3,3-dimethylurea.
| Compound Name | 1-ethyl-1-(furan-2-ylmethyl)-3,3-dimethylurea |
|---|---|
| PubChem CID | 115581572 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-ethyl-1-(furan-2-ylmethyl)-3,3-dimethylurea |
| SMILES | CCN(Cc1ccco1)C(=O)N(C)C |
| InChI | InChI=1S/C10H16N2O2/c1-4-12(10(13)11(2)3)8-9-6-5-7-14-9/h5-7H,4,8H2,1-3H3 |
| InChIKey | DKWRSXPGMYROBY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |