C11H10ClF3N2O3S — CID 115582134
3-chloro-4-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 115582134) has the molecular formula C11H10ClF3N2O3S and a molecular weight of 342.73 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 115582134 |
| Molecular Formula | C11H10ClF3N2O3S |
| Molecular Weight | 342.73 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-chloro-4-cyano-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCOCC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H10ClF3N2O3S/c12-10-5-9(2-1-8(10)6-16)21(18,19)17-3-4-20-7-11(13,14)15/h1-2,5,17H,3-4,7H2 |
| InChIKey | HOUQUBLEMHRLPK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.73 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|