C16H22O4 — CID 115582293
1-cyclohexyl-2-(3,5-dimethoxyphenoxy)ethanone (PubChem CID 115582293) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-cyclohexyl-2-(3,5-dimethoxyphenoxy)ethanone.
| Compound Name | 1-cyclohexyl-2-(3,5-dimethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 115582293 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-cyclohexyl-2-(3,5-dimethoxyphenoxy)ethanone |
| SMILES | COc1cc(OC)cc(OCC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C16H22O4/c1-18-13-8-14(19-2)10-15(9-13)20-11-16(17)12-6-4-3-5-7-12/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | ICQUOXKOGAZJKD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |