C11H21N3O2 — CID 115583146
1-N,1-N-diethylpiperidine-1,2-dicarboxamide (PubChem CID 115583146) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 1-N,1-N-diethylpiperidine-1,2-dicarboxamide.
| Compound Name | 1-N,1-N-diethylpiperidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 115583146 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 1-N,1-N-diethylpiperidine-1,2-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCCCC1C(N)=O |
| InChI | InChI=1S/C11H21N3O2/c1-3-13(4-2)11(16)14-8-6-5-7-9(14)10(12)15/h9H,3-8H2,1-2H3,(H2,12,15) |
| InChIKey | VWMKSBBSUUTYRN-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |