C12H21N3S — CID 115583468
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-cyclopropylthiourea (PubChem CID 115583468) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-cyclopropylthiourea.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 115583468 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-cyclopropylthiourea |
| SMILES | S=C(NC1CC1)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C12H21N3S/c16-12(13-9-4-5-9)14-10-6-8-15-7-2-1-3-11(10)15/h9-11H,1-8H2,(H2,13,14,16) |
| InChIKey | DPZOQJYCZIXHFK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|