C18H30OSi — CID 11558351
(4aS,7R)-3,5,5,9-tetramethyl-7-trimethylsilyl-2,4a,7,8-tetrahydro-1H-benzo[7]annulen-6-one (PubChem CID 11558351) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is (4aS,7R)-3,5,5,9-tetramethyl-7-trimethylsilyl-2,4a,7,8-tetrahydro-1H-benzo[7]annulen-6-one.
| Compound Name | (4aS,7R)-3,5,5,9-tetramethyl-7-trimethylsilyl-2,4a,7,8-tetrahydro-1H-benzo[7]annulen-6-one |
|---|---|
| PubChem CID | 11558351 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (4aS,7R)-3,5,5,9-tetramethyl-7-trimethylsilyl-2,4a,7,8-tetrahydro-1H-benzo[7]annulen-6-one |
| SMILES | CC1=C[C@H]2C(=C(C)C[C@@H]([Si](C)(C)C)C(=O)C2(C)C)CC1 |
| InChI | InChI=1S/C18H30OSi/c1-12-8-9-14-13(2)11-16(20(5,6)7)17(19)18(3,4)15(14)10-12/h10,15-16H,8-9,11H2,1-7H3/t15-,16+/m0/s1 |
| InChIKey | DSWHBQDNFCQRST-JKSUJKDBSA-N |
| XLogP | 5.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|