C5H10F3N3O3S — CID 115583982
1-(2-sulfamoylethyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 115583982) has the molecular formula C5H10F3N3O3S and a molecular weight of 249.21 g/mol. Its IUPAC name is 1-(2-sulfamoylethyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-sulfamoylethyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 115583982 |
| Molecular Formula | C5H10F3N3O3S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 1-(2-sulfamoylethyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | NS(=O)(=O)CCNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H10F3N3O3S/c6-5(7,8)3-11-4(12)10-1-2-15(9,13)14/h1-3H2,(H2,9,13,14)(H2,10,11,12) |
| InChIKey | UPUBJLQNQIQOSH-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |