C8H7Cl2F3N2O2 — CID 115584264
4,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one (PubChem CID 115584264) has the molecular formula C8H7Cl2F3N2O2 and a molecular weight of 291.06 g/mol. Its IUPAC name is 4,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 115584264 |
| Molecular Formula | C8H7Cl2F3N2O2 |
| Molecular Weight | 291.06 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 4,5-dichloro-2-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CCOCC(F)(F)F |
| InChI | InChI=1S/C8H7Cl2F3N2O2/c9-5-3-14-15(7(16)6(5)10)1-2-17-4-8(11,12)13/h3H,1-2,4H2 |
| InChIKey | HYSLJLVMYLDLKL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.06 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|