C10H12N2O4 — CID 115584292
methyl 2-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]acetate (PubChem CID 115584292) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is methyl 2-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 115584292 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | methyl 2-[(6-methyl-2-oxo-1H-pyridine-3-carbonyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(C)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O4/c1-6-3-4-7(10(15)12-6)9(14)11-5-8(13)16-2/h3-4H,5H2,1-2H3,(H,11,14)(H,12,15) |
| InChIKey | PIXJLJJSDCMGEI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |