C14H16N2O3 — CID 115585264
2-[4-[(furan-3-ylmethylamino)methyl]phenoxy]acetamide (PubChem CID 115585264) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[4-[(furan-3-ylmethylamino)methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(furan-3-ylmethylamino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 115585264 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[4-[(furan-3-ylmethylamino)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(CNCc2ccoc2)cc1 |
| InChI | InChI=1S/C14H16N2O3/c15-14(17)10-19-13-3-1-11(2-4-13)7-16-8-12-5-6-18-9-12/h1-6,9,16H,7-8,10H2,(H2,15,17) |
| InChIKey | NCVKKEOQFKSTGB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |