C10H23ClNO5P — CID 11558541
(2R,3S,4R,5S)-2-(diethoxyphosphorylmethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride (PubChem CID 11558541) has the molecular formula C10H23ClNO5P and a molecular weight of 303.72 g/mol. Its IUPAC name is (2R,3S,4R,5S)-2-(diethoxyphosphorylmethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride.
| Compound Name | (2R,3S,4R,5S)-2-(diethoxyphosphorylmethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 11558541 |
| Molecular Formula | C10H23ClNO5P |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R,3S,4R,5S)-2-(diethoxyphosphorylmethyl)-5-methylpyrrolidine-3,4-diol;hydrochloride |
| SMILES | CCOP(=O)(C[C@@H]1N[C@@H](C)[C@@H](O)[C@H]1O)OCC.Cl |
| InChI | InChI=1S/C10H22NO5P.ClH/c1-4-15-17(14,16-5-2)6-8-10(13)9(12)7(3)11-8;/h7-13H,4-6H2,1-3H3;1H/t7-,8-,9+,10-;/m0./s1 |
| InChIKey | YPBUVWNPYZNYOK-PZNADOJNSA-N |
| XLogP | 0.76 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|