C16H12FN3OS — CID 11558682
4-(dimethylamino)-15-fluoro-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one (PubChem CID 11558682) has the molecular formula C16H12FN3OS and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-(dimethylamino)-15-fluoro-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one.
| Compound Name | 4-(dimethylamino)-15-fluoro-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
|---|---|
| PubChem CID | 11558682 |
| Molecular Formula | C16H12FN3OS |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-(dimethylamino)-15-fluoro-5-thia-3,10-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7(12),8,14,16-heptaen-11-one |
| SMILES | CN(C)c1nc2c3ccc(F)cc3c3c(=O)[nH]ccc3c2s1 |
| InChI | InChI=1S/C16H12FN3OS/c1-20(2)16-19-13-9-4-3-8(17)7-11(9)12-10(14(13)22-16)5-6-18-15(12)21/h3-7H,1-2H3,(H,18,21) |
| InChIKey | JRZFUZMJLKRZRF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|