About 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid
7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid (PubChem CID 115586989) has the molecular formula C14H8Cl2N2O2S
and a molecular weight of 339.20 g/mol. Its IUPAC name is 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid |
| PubChem CID | 115586989 |
| Molecular Formula | C14H8Cl2N2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid |
| SMILES | Cc1nc(-c2cc(C(=O)O)c3ccc(Cl)c(Cl)c3n2)cs1 |
| InChI | InChI=1S/C14H8Cl2N2O2S/c1-6-17-11(5-21-6)10-4-8(14(19)20)7-2-3-9(15)12(16)13(7)18-10/h2-5H,1H3,(H,19,20) |
| InChIKey | BMRDIHPITGSVKU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid?
The IUPAC name of 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid (CID 115586989) is 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid.
What is the SMILES notation for 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid?
The canonical SMILES for 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid is Cc1nc(-c2cc(C(=O)O)c3ccc(Cl)c(Cl)c3n2)cs1.
What is the InChIKey of 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid?
The InChIKey is BMRDIHPITGSVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2O2S/c1-6-17-11(5-21-6)10-4-8(14(19)20)7-2-3-9(15)12(16)13(7)18-10/h2-5H,1H3,(H,19,20).
What are the key properties of 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid?
7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid has a molecular weight of 339.20 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dichloro-2-(2-methyl-1,3-thiazol-4-yl)quinoline-4-carboxylic acid is sourced from PubChem (CID 115586989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).